C33H53NO5SSi — CID 70803671
(4S,10E,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 70803671) has the molecular formula C33H53NO5SSi and a molecular weight of 603.94 g/mol. Its IUPAC name is (4S,10E,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,10E,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 70803671 |
| Molecular Formula | C33H53NO5SSi |
| Molecular Weight | 603.94 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | (4S,10E,13Z)-8-hydroxy-5,5,7,9,13-pentamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(=O)OC(/C(C)=C/c2csc(C)n2)C/C=C(/C)C/C=C/C(C)C(O)C(C)C(=O)C1(C)C |
| InChI | InChI=1S/C33H53NO5SSi/c1-11-41(12-2,13-3)39-29-20-30(35)38-28(24(6)19-27-21-40-26(8)34-27)18-17-22(4)15-14-16-23(5)31(36)25(7)32(37)33(29,9)10/h14,16-17,19,21,23,25,28-29,31,36H,11-13,15,18,20H2,1-10H3/b16-14+,22-17-,24-19+/t23?,25?,28?,29-,31?/m0/s1 |
| InChIKey | OPAQMONDKCJQRX-BSIWPBRISA-N |
| XLogP | 8.07 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.94 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|