C41H53N7O6Si — CID 70803750
tert-butyl 2-[5-[(1-benzylpyrazol-4-yl)carbamoyl]-3-(2-trimethylsilylethoxymethyl)-2H-1,3-oxazepin-7-yl]-5-(4-methylpiperazine-1-carbonyl)indole-1-carboxylate (PubChem CID 70803750) has the molecular formula C41H53N7O6Si and a molecular weight of 768.00 g/mol. Its IUPAC name is tert-butyl 2-[5-[(1-benzylpyrazol-4-yl)carbamoyl]-3-(2-trimethylsilylethoxymethyl)-2H-1,3-oxazepin-7-yl]-5-(4-methylpiperazine-1-carbonyl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-[5-[(1-benzylpyrazol-4-yl)carbamoyl]-3-(2-trimethylsilylethoxymethyl)-2H-1,3-oxazepin-7-yl]-5-(4-methylpiperazine-1-carbonyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 70803750 |
| Molecular Formula | C41H53N7O6Si |
| Molecular Weight | 768.00 g/mol |
| Exact Mass | 767.38 |
| IUPAC Name | tert-butyl 2-[5-[(1-benzylpyrazol-4-yl)carbamoyl]-3-(2-trimethylsilylethoxymethyl)-2H-1,3-oxazepin-7-yl]-5-(4-methylpiperazine-1-carbonyl)indole-1-carboxylate |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)cc(C2=CC(C(=O)Nc4cnn(Cc5ccccc5)c4)=CN(COCC[Si](C)(C)C)CO2)n3C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C41H53N7O6Si/c1-41(2,3)54-40(51)48-35-14-13-31(39(50)46-17-15-44(4)16-18-46)21-32(35)22-36(48)37-23-33(26-45(29-53-37)28-52-19-20-55(5,6)7)38(49)43-34-24-42-47(27-34)25-30-11-9-8-10-12-30/h8-14,21-24,26-27H,15-20,25,28-29H2,1-7H3,(H,43,49) |
| InChIKey | YPVJATVJDMEVKK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.00 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|