C13H17F3N2 — CID 70804072
(2S)-2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]piperazine (PubChem CID 70804072) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is (2S)-2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]piperazine.
| Compound Name | (2S)-2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 70804072 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (2S)-2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]piperazine |
| SMILES | CC1CN(c2ccc(C(F)(F)F)cc2)[C@@H](C)CN1 |
| InChI | InChI=1S/C13H17F3N2/c1-9-8-18(10(2)7-17-9)12-5-3-11(4-6-12)13(14,15)16/h3-6,9-10,17H,7-8H2,1-2H3/t9?,10-/m0/s1 |
| InChIKey | FYDUFKKWJFNDSY-AXDSSHIGSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |