C26H32ClF2N3O3 — CID 70804159
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-[4-(fluoromethoxy)-3-(fluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 70804159) has the molecular formula C26H32ClF2N3O3 and a molecular weight of 508.01 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-[4-(fluoromethoxy)-3-(fluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-[4-(fluoromethoxy)-3-(fluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 70804159 |
| Molecular Formula | C26H32ClF2N3O3 |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-[4-(fluoromethoxy)-3-(fluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | O=C(COC1CCC(Nc2ccc(OCF)c(CF)c2)CC1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H32ClF2N3O3/c27-20-1-6-23(7-2-20)31-11-13-32(14-12-31)26(33)17-34-24-8-3-21(4-9-24)30-22-5-10-25(35-18-29)19(15-22)16-28/h1-2,5-7,10,15,21,24,30H,3-4,8-9,11-14,16-18H2 |
| InChIKey | CUUKETVMZIIPCE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|