C27H35FN4O6 — CID 70804203
1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxyethanone (PubChem CID 70804203) has the molecular formula C27H35FN4O6 and a molecular weight of 530.60 g/mol. Its IUPAC name is 1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 70804203 |
| Molecular Formula | C27H35FN4O6 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxyethanone |
| SMILES | COc1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc([N+](=O)[O-])c(CF)c4)CC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H35FN4O6/c1-36-23-8-10-25(26(16-23)37-2)30-11-13-31(14-12-30)27(33)18-38-22-6-3-20(4-7-22)29-21-5-9-24(32(34)35)19(15-21)17-28/h5,8-10,15-16,20,22,29H,3-4,6-7,11-14,17-18H2,1-2H3 |
| InChIKey | XZJHIFWLDVJVPV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|