C19H13IN6S — CID 70804252
2-(2-amino-4-pyridinyl)-4-(2-iodo-4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile (PubChem CID 70804252) has the molecular formula C19H13IN6S and a molecular weight of 484.33 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-4-(2-iodo-4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile.
| Compound Name | 2-(2-amino-4-pyridinyl)-4-(2-iodo-4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 70804252 |
| Molecular Formula | C19H13IN6S |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-4-(2-iodo-4-methylphenyl)-5-(1H-1,2,4-triazol-5-yl)thiophene-3-carbonitrile |
| SMILES | Cc1ccc(-c2c(-c3ncn[nH]3)sc(-c3ccnc(N)c3)c2C#N)c(I)c1 |
| InChI | InChI=1S/C19H13IN6S/c1-10-2-3-12(14(20)6-10)16-13(8-21)17(11-4-5-23-15(22)7-11)27-18(16)19-24-9-25-26-19/h2-7,9H,1H3,(H2,22,23)(H,24,25,26) |
| InChIKey | ABLIGFNMJHPOMC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|