C23H31NO5S — CID 70805153
3-[[4-[[(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]cyclohexyl]amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid (PubChem CID 70805153) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is 3-[[4-[[(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]cyclohexyl]amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[[4-[[(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]cyclohexyl]amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 70805153 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 3-[[4-[[(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxy]cyclohexyl]amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)C#Cc1cc(NC2CCC(O[C@@H]3CO[C@H]4OCC[C@H]43)CC2)c(C(=O)O)s1 |
| InChI | InChI=1S/C23H31NO5S/c1-23(2,3)10-8-16-12-18(20(30-16)21(25)26)24-14-4-6-15(7-5-14)29-19-13-28-22-17(19)9-11-27-22/h12,14-15,17,19,22,24H,4-7,9,11,13H2,1-3H3,(H,25,26)/t14?,15?,17-,19+,22+/m0/s1 |
| InChIKey | OJBDCDMMLJXLDT-NNRLUZGNSA-N |
| XLogP | 4.34 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|