C25H29IN4O — CID 70805246
4-[2-(4-iodophenyl)ethyl]-1-(6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-yl)piperazin-2-one (PubChem CID 70805246) has the molecular formula C25H29IN4O and a molecular weight of 528.44 g/mol. Its IUPAC name is 4-[2-(4-iodophenyl)ethyl]-1-(6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-yl)piperazin-2-one.
| Compound Name | 4-[2-(4-iodophenyl)ethyl]-1-(6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-yl)piperazin-2-one |
|---|---|
| PubChem CID | 70805246 |
| Molecular Formula | C25H29IN4O |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 4-[2-(4-iodophenyl)ethyl]-1-(6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-yl)piperazin-2-one |
| SMILES | Cn1c2c(c3ccc(N4CCN(CCc5ccc(I)cc5)CC4=O)cc31)CCNCC2 |
| InChI | InChI=1S/C25H29IN4O/c1-28-23-9-12-27-11-8-22(23)21-7-6-20(16-24(21)28)30-15-14-29(17-25(30)31)13-10-18-2-4-19(26)5-3-18/h2-7,16,27H,8-15,17H2,1H3 |
| InChIKey | OJBUIIRYZTULTA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|