C53H52O6 — CID 70805599
[(1R,2S,13S,15R)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-8-(trityloxymethyl)-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-(4-phenylphenyl)acetate (PubChem CID 70805599) has the molecular formula C53H52O6 and a molecular weight of 784.99 g/mol. Its IUPAC name is [(1R,2S,13S,15R)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-8-(trityloxymethyl)-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [(1R,2S,13S,15R)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-8-(trityloxymethyl)-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 70805599 |
| Molecular Formula | C53H52O6 |
| Molecular Weight | 784.99 g/mol |
| Exact Mass | 784.38 |
| IUPAC Name | [(1R,2S,13S,15R)-1,6-dihydroxy-4,12,12,15-tetramethyl-5-oxo-8-(trityloxymethyl)-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-(4-phenylphenyl)acetate |
| SMILES | CC1=C[C@@H]2C(O)(CC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)=CC3C4C(C)(C)[C@]4(OC(=O)Cc4ccc(-c5ccccc5)cc4)C[C@@H](C)[C@@]32O)C1=O |
| InChI | InChI=1S/C53H52O6/c1-35-29-45-50(56,48(35)55)33-38(34-58-53(41-19-11-6-12-20-41,42-21-13-7-14-22-42)43-23-15-8-16-24-43)30-44-47-49(3,4)51(47,32-36(2)52(44,45)57)59-46(54)31-37-25-27-40(28-26-37)39-17-9-5-10-18-39/h5-30,36,44-45,47,56-57H,31-34H2,1-4H3/t36-,44?,45-,47?,50?,51+,52-/m1/s1 |
| InChIKey | WTMBOBYXUTYMOH-YPXWOXJTSA-N |
| XLogP | 9.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.99 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|