C16H26O5 — CID 70805836
(1'R,2'R,3'aR,6'aS)-2'-ethoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid (PubChem CID 70805836) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1'R,2'R,3'aR,6'aS)-2'-ethoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid.
| Compound Name | (1'R,2'R,3'aR,6'aS)-2'-ethoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid |
|---|---|
| PubChem CID | 70805836 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (1'R,2'R,3'aR,6'aS)-2'-ethoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylic acid |
| SMILES | CCO[C@@H]1C[C@@H]2CC3(C[C@@H]2[C@H]1C(=O)O)OCC(C)(C)CO3 |
| InChI | InChI=1S/C16H26O5/c1-4-19-12-5-10-6-16(7-11(10)13(12)14(17)18)20-8-15(2,3)9-21-16/h10-13H,4-9H2,1-3H3,(H,17,18)/t10-,11+,12-,13-/m1/s1 |
| InChIKey | KOVFNFKOGFQQNV-YVECIDJPSA-N |
| XLogP | 2.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |