C30H54O5Si — CID 70805910
(6Z,8aR,9R,10R,11aS)-10-[tert-butyl(dimethyl)silyl]oxy-9-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one (PubChem CID 70805910) has the molecular formula C30H54O5Si and a molecular weight of 522.84 g/mol. Its IUPAC name is (6Z,8aR,9R,10R,11aS)-10-[tert-butyl(dimethyl)silyl]oxy-9-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one.
| Compound Name | (6Z,8aR,9R,10R,11aS)-10-[tert-butyl(dimethyl)silyl]oxy-9-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
|---|---|
| PubChem CID | 70805910 |
| Molecular Formula | C30H54O5Si |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | (6Z,8aR,9R,10R,11aS)-10-[tert-butyl(dimethyl)silyl]oxy-9-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
| SMILES | CCCCCCCC1(CC[C@@H]2[C@H]3C/C=C\CCCC(=O)O[C@H]3C[C@H]2O[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C30H54O5Si/c1-7-8-9-12-15-19-30(32-21-22-33-30)20-18-25-24-16-13-10-11-14-17-28(31)34-26(24)23-27(25)35-36(5,6)29(2,3)4/h10,13,24-27H,7-9,11-12,14-23H2,1-6H3/b13-10-/t24-,25-,26+,27-/m1/s1 |
| InChIKey | LCYXPSRWRDWCNI-XUJLCYJHSA-N |
| XLogP | 7.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|