C14H20O4 — CID 70807253
(11Z,12aS)-11-(hydroxymethylidene)-12a-methyl-3,5,6,7,8,12-hexahydro-2H-1,4-benzodioxecin-10-one (PubChem CID 70807253) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (11Z,12aS)-11-(hydroxymethylidene)-12a-methyl-3,5,6,7,8,12-hexahydro-2H-1,4-benzodioxecin-10-one.
| Compound Name | (11Z,12aS)-11-(hydroxymethylidene)-12a-methyl-3,5,6,7,8,12-hexahydro-2H-1,4-benzodioxecin-10-one |
|---|---|
| PubChem CID | 70807253 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (11Z,12aS)-11-(hydroxymethylidene)-12a-methyl-3,5,6,7,8,12-hexahydro-2H-1,4-benzodioxecin-10-one |
| SMILES | C[C@]12C/C(=C/O)C(=O)C=C1CCCCOCCO2 |
| InChI | InChI=1S/C14H20O4/c1-14-9-11(10-15)13(16)8-12(14)4-2-3-5-17-6-7-18-14/h8,10,15H,2-7,9H2,1H3/b11-10-/t14-/m0/s1 |
| InChIKey | KCUUXLNAJOBILU-BMSUMIBZSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|