C27H40O — CID 70807472
(4bR,8aR)-2-(2-cycloheptylpropan-2-yl)-6,9,9-trimethyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol (PubChem CID 70807472) has the molecular formula C27H40O and a molecular weight of 380.62 g/mol. Its IUPAC name is (4bR,8aR)-2-(2-cycloheptylpropan-2-yl)-6,9,9-trimethyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol.
| Compound Name | (4bR,8aR)-2-(2-cycloheptylpropan-2-yl)-6,9,9-trimethyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol |
|---|---|
| PubChem CID | 70807472 |
| Molecular Formula | C27H40O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (4bR,8aR)-2-(2-cycloheptylpropan-2-yl)-6,9,9-trimethyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(C(C)(C)C3CCCCCC3)cc1CC2(C)C |
| InChI | InChI=1S/C27H40O/c1-18-12-13-23-22(14-18)25-19(17-26(23,2)3)15-21(16-24(25)28)27(4,5)20-10-8-6-7-9-11-20/h12,15-16,20,22-23,28H,6-11,13-14,17H2,1-5H3/t22-,23-/m1/s1 |
| InChIKey | GRYKZQCBUPUYBV-DHIUTWEWSA-N |
| XLogP | 7.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|