C19H32O4 — CID 70807533
(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 70807533) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 70807533 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OC1C(=O)OC2CCCC21)C(C)(C)C |
| InChI | InChI=1S/C19H32O4/c1-17(2,3)11-19(7,18(4,5)6)16(21)23-14-12-9-8-10-13(12)22-15(14)20/h12-14H,8-11H2,1-7H3 |
| InChIKey | FILKSZAFMRIPSM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |