About N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide
N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 7080793) has the molecular formula C23H21N3O5
and a molecular weight of 419.44 g/mol. Its IUPAC name is N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
Molecular Properties
| Compound Name | N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| PubChem CID | 7080793 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | COc1ccc(OC)c2[nH]c(=O)c(CCNC(=O)C(=O)c3c[nH]c4ccccc34)cc12 |
| InChI | InChI=1S/C23H21N3O5/c1-30-18-7-8-19(31-2)20-15(18)11-13(22(28)26-20)9-10-24-23(29)21(27)16-12-25-17-6-4-3-5-14(16)17/h3-8,11-12,25H,9-10H2,1-2H3,(H,24,29)(H,26,28) |
| InChIKey | UYUOVVKIXOWLSG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
The IUPAC name of N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide (CID 7080793) is N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
What is the SMILES notation for N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
The canonical SMILES for N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide is COc1ccc(OC)c2[nH]c(=O)c(CCNC(=O)C(=O)c3c[nH]c4ccccc34)cc12.
What is the InChIKey of N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
The InChIKey is UYUOVVKIXOWLSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O5/c1-30-18-7-8-19(31-2)20-15(18)11-13(22(28)26-20)9-10-24-23(29)21(27)16-12-25-17-6-4-3-5-14(16)17/h3-8,11-12,25H,9-10H2,1-2H3,(H,24,29)(H,26,28).
What are the key properties of N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide?
N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide has a molecular weight of 419.44 g/mol, XLogP of 2.57, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide is sourced from PubChem (CID 7080793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).