C37H39F3N6O3 — CID 70808096
(6aS)-2-methyl-3-[5-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]pentoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 70808096) has the molecular formula C37H39F3N6O3 and a molecular weight of 672.75 g/mol. Its IUPAC name is (6aS)-2-methyl-3-[5-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]pentoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-2-methyl-3-[5-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]pentoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 70808096 |
| Molecular Formula | C37H39F3N6O3 |
| Molecular Weight | 672.75 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | (6aS)-2-methyl-3-[5-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]pentoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | Cc1cc2c(cc1OCCCCCN1CCN(C(=O)c3nc(-c4ccc(C(F)(F)F)cc4)n4ccccc34)CC1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C37H39F3N6O3/c1-25-22-29-30(41-24-28-8-7-16-45(28)35(29)47)23-32(25)49-21-6-2-4-14-43-17-19-44(20-18-43)36(48)33-31-9-3-5-15-46(31)34(42-33)26-10-12-27(13-11-26)37(38,39)40/h3,5,9-13,15,22-24,28H,2,4,6-8,14,16-21H2,1H3/t28-/m0/s1 |
| InChIKey | GIIVKLXDRSGZLQ-NDEPHWFRSA-N |
| XLogP | 6.66 |
| TPSA | 82.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|