C38H41F3N6O3 — CID 70808097
(6aS)-2-methyl-3-[6-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 70808097) has the molecular formula C38H41F3N6O3 and a molecular weight of 686.78 g/mol. Its IUPAC name is (6aS)-2-methyl-3-[6-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-2-methyl-3-[6-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 70808097 |
| Molecular Formula | C38H41F3N6O3 |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | (6aS)-2-methyl-3-[6-[4-[3-[4-(trifluoromethyl)phenyl]imidazo[1,5-a]pyridine-1-carbonyl]piperazin-1-yl]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | Cc1cc2c(cc1OCCCCCCN1CCN(C(=O)c3nc(-c4ccc(C(F)(F)F)cc4)n4ccccc34)CC1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C38H41F3N6O3/c1-26-23-30-31(42-25-29-9-8-17-46(29)36(30)48)24-33(26)50-22-7-3-2-5-15-44-18-20-45(21-19-44)37(49)34-32-10-4-6-16-47(32)35(43-34)27-11-13-28(14-12-27)38(39,40)41/h4,6,10-14,16,23-25,29H,2-3,5,7-9,15,17-22H2,1H3/t29-/m0/s1 |
| InChIKey | WQBBPXJMHWSFIL-LJAQVGFWSA-N |
| XLogP | 7.05 |
| TPSA | 82.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|