About 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione
6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione (PubChem CID 7080834) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 7080834 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)cc(Nc2ccc(C)c(C)c2)[nH]c1=O |
| InChI | InChI=1S/C14H17N3O2/c1-4-17-13(18)8-12(16-14(17)19)15-11-6-5-9(2)10(3)7-11/h5-8,15H,4H2,1-3H3,(H,16,19) |
| InChIKey | ZGLXSQMPMCKTBF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione (CID 7080834) is 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione is CCn1c(=O)cc(Nc2ccc(C)c(C)c2)[nH]c1=O.
What is the InChIKey of 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione?
The InChIKey is ZGLXSQMPMCKTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-4-17-13(18)8-12(16-14(17)19)15-11-6-5-9(2)10(3)7-11/h5-8,15H,4H2,1-3H3,(H,16,19).
What are the key properties of 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione?
6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione has a molecular weight of 259.31 g/mol, XLogP of 1.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethylanilino)-3-ethyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 7080834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).