C34H50N4O3 — CID 70808434
tert-butyl (4R)-2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 70808434) has the molecular formula C34H50N4O3 and a molecular weight of 562.80 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70808434 |
| Molecular Formula | C34H50N4O3 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CN2CCN(c3cccc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)n3)CC2)COC1(C)C |
| InChI | InChI=1S/C34H50N4O3/c1-31(2,3)41-30(39)38-25(23-40-34(38,8)9)22-36-17-19-37(20-18-36)29-12-10-11-28(35-29)24-13-14-26-27(21-24)33(6,7)16-15-32(26,4)5/h10-14,21,25H,15-20,22-23H2,1-9H3/t25-/m1/s1 |
| InChIKey | HGXAGQORURWPSM-RUZDIDTESA-N |
| XLogP | 6.59 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |