C15H25NO5 — CID 70808967
ethyl (3aR,4R,6S,7R,7aS)-7-acetamido-2,2,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 70808967) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl (3aR,4R,6S,7R,7aS)-7-acetamido-2,2,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,4R,6S,7R,7aS)-7-acetamido-2,2,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 70808967 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | ethyl (3aR,4R,6S,7R,7aS)-7-acetamido-2,2,6-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](C)[C@@H](NC(C)=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C15H25NO5/c1-6-19-14(18)10-7-8(2)11(16-9(3)17)13-12(10)20-15(4,5)21-13/h8,10-13H,6-7H2,1-5H3,(H,16,17)/t8-,10+,11+,12+,13-/m0/s1 |
| InChIKey | WQXNYFJIBGUJMK-ODSNKANHSA-N |
| XLogP | 1.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |