C51H38N4 — CID 70809031
12-cyclohexa-2,4-dien-1-yl-14-[5-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-16-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,9,11,15,17-octaene (PubChem CID 70809031) has the molecular formula C51H38N4 and a molecular weight of 706.89 g/mol. Its IUPAC name is 12-cyclohexa-2,4-dien-1-yl-14-[5-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-16-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,9,11,15,17-octaene.
| Compound Name | 12-cyclohexa-2,4-dien-1-yl-14-[5-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-16-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,9,11,15,17-octaene |
|---|---|
| PubChem CID | 70809031 |
| Molecular Formula | C51H38N4 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.31 |
| IUPAC Name | 12-cyclohexa-2,4-dien-1-yl-14-[5-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-16-phenyl-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,9,11,15,17-octaene |
| SMILES | C1=CCC(C2=CC=CC3c4ccccc4-c4cccc(-c5ccccc5)c4N(c4ccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cn4)C23)C=C1 |
| InChI | InChI=1S/C51H38N4/c1-5-17-35(18-6-1)40-27-15-29-44-42-25-13-14-26-43(42)45-30-16-28-41(36-19-7-2-8-20-36)50(45)55(49(40)44)48-32-31-39(34-52-48)51-53-46(37-21-9-3-10-22-37)33-47(54-51)38-23-11-4-12-24-38/h1-19,21-34,36,45,50H,20H2 |
| InChIKey | FRLXPMHBIVMUHI-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |