C48H96O4S — CID 70809132
4-(4-methylsulfonylbutyl)-2,2-bis(3,7,11,15-tetramethylhexadecyl)-1,3-dioxolane (PubChem CID 70809132) has the molecular formula C48H96O4S and a molecular weight of 769.36 g/mol. Its IUPAC name is 4-(4-methylsulfonylbutyl)-2,2-bis(3,7,11,15-tetramethylhexadecyl)-1,3-dioxolane.
| Compound Name | 4-(4-methylsulfonylbutyl)-2,2-bis(3,7,11,15-tetramethylhexadecyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 70809132 |
| Molecular Formula | C48H96O4S |
| Molecular Weight | 769.36 g/mol |
| Exact Mass | 768.70 |
| IUPAC Name | 4-(4-methylsulfonylbutyl)-2,2-bis(3,7,11,15-tetramethylhexadecyl)-1,3-dioxolane |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCC1(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)OCC(CCCCS(C)(=O)=O)O1 |
| InChI | InChI=1S/C48H96O4S/c1-39(2)20-14-22-41(5)24-16-26-43(7)28-18-30-45(9)33-35-48(51-38-47(52-48)32-12-13-37-53(11,49)50)36-34-46(10)31-19-29-44(8)27-17-25-42(6)23-15-21-40(3)4/h39-47H,12-38H2,1-11H3 |
| InChIKey | WEEGBGDUJBBMIL-UHFFFAOYSA-N |
| XLogP | 15.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.36 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|