C18H35N3O4S — CID 7080927
1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 7080927) has the molecular formula C18H35N3O4S and a molecular weight of 389.56 g/mol. Its IUPAC name is 1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7080927 |
| Molecular Formula | C18H35N3O4S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(S(=O)(=O)N2C[C@H](C)C[C@@H](C)C2)CC1 |
| InChI | InChI=1S/C18H35N3O4S/c1-4-25-11-5-8-19-18(22)17-6-9-20(10-7-17)26(23,24)21-13-15(2)12-16(3)14-21/h15-17H,4-14H2,1-3H3,(H,19,22)/t15-,16-/m1/s1 |
| InChIKey | YZZRDYOGZSMUSS-HZPDHXFCSA-N |
| XLogP | 1.46 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|