C32H28N4 — CID 70809935
9-[4-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-5-naphthalen-2-yl-1,2,4-triazol-3-yl]-3,4-dihydrocarbazole (PubChem CID 70809935) has the molecular formula C32H28N4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 9-[4-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-5-naphthalen-2-yl-1,2,4-triazol-3-yl]-3,4-dihydrocarbazole.
| Compound Name | 9-[4-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-5-naphthalen-2-yl-1,2,4-triazol-3-yl]-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 70809935 |
| Molecular Formula | C32H28N4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 9-[4-(3,5-dimethylcyclohexa-1,3-dien-1-yl)-5-naphthalen-2-yl-1,2,4-triazol-3-yl]-3,4-dihydrocarbazole |
| SMILES | CC1=CC(C)CC(n2c(-c3ccc4ccccc4c3)nnc2-n2c3c(c4ccccc42)CCC=C3)=C1 |
| InChI | InChI=1S/C32H28N4/c1-21-17-22(2)19-26(18-21)35-31(25-16-15-23-9-3-4-10-24(23)20-25)33-34-32(35)36-29-13-7-5-11-27(29)28-12-6-8-14-30(28)36/h3-5,7-11,13-18,20,22H,6,12,19H2,1-2H3 |
| InChIKey | VQZXHLBFJYJHOP-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |