C20H23F3N2O2 — CID 70810503
3-methyl-N-(3-methylbutyl)-4-[2-(trifluoromethoxy)anilino]benzamide (PubChem CID 70810503) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-methyl-N-(3-methylbutyl)-4-[2-(trifluoromethoxy)anilino]benzamide.
| Compound Name | 3-methyl-N-(3-methylbutyl)-4-[2-(trifluoromethoxy)anilino]benzamide |
|---|---|
| PubChem CID | 70810503 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-methyl-N-(3-methylbutyl)-4-[2-(trifluoromethoxy)anilino]benzamide |
| SMILES | Cc1cc(C(=O)NCCC(C)C)ccc1Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O2/c1-13(2)10-11-24-19(26)15-8-9-16(14(3)12-15)25-17-6-4-5-7-18(17)27-20(21,22)23/h4-9,12-13,25H,10-11H2,1-3H3,(H,24,26) |
| InChIKey | RNBUIKDGOBLRDI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |