C18H10F2IN3O3S2 — CID 70810622
N-[2,4-difluoro-3-(5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]thiophene-3-sulfonamide (PubChem CID 70810622) has the molecular formula C18H10F2IN3O3S2 and a molecular weight of 545.33 g/mol. Its IUPAC name is N-[2,4-difluoro-3-(5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]thiophene-3-sulfonamide.
| Compound Name | N-[2,4-difluoro-3-(5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 70810622 |
| Molecular Formula | C18H10F2IN3O3S2 |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 544.92 |
| IUPAC Name | N-[2,4-difluoro-3-(5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]thiophene-3-sulfonamide |
| SMILES | O=C(c1c(F)ccc(NS(=O)(=O)c2ccsc2)c1F)c1c[nH]c2ncc(I)cc12 |
| InChI | InChI=1S/C18H10F2IN3O3S2/c19-13-1-2-14(24-29(26,27)10-3-4-28-8-10)16(20)15(13)17(25)12-7-23-18-11(12)5-9(21)6-22-18/h1-8,24H,(H,22,23) |
| InChIKey | YPFFXSHCPFSAIQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|