C18H23N3O2 — CID 70810642
(2R,3R)-3-methoxy-2-methyl-3-pyrrolidin-2-yl-N-quinolin-2-ylpropanamide (PubChem CID 70810642) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-2-methyl-3-pyrrolidin-2-yl-N-quinolin-2-ylpropanamide.
| Compound Name | (2R,3R)-3-methoxy-2-methyl-3-pyrrolidin-2-yl-N-quinolin-2-ylpropanamide |
|---|---|
| PubChem CID | 70810642 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2R,3R)-3-methoxy-2-methyl-3-pyrrolidin-2-yl-N-quinolin-2-ylpropanamide |
| SMILES | CO[C@@H](C1CCCN1)[C@@H](C)C(=O)Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H23N3O2/c1-12(17(23-2)15-8-5-11-19-15)18(22)21-16-10-9-13-6-3-4-7-14(13)20-16/h3-4,6-7,9-10,12,15,17,19H,5,8,11H2,1-2H3,(H,20,21,22)/t12-,15?,17-/m1/s1 |
| InChIKey | UVQRKUUINFYULK-XURPUJGUSA-N |
| XLogP | 2.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |