C29H36N2O3 — CID 70811535
3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-[2-(methylamino)-2-oxoethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide (PubChem CID 70811535) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-[2-(methylamino)-2-oxoethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide.
| Compound Name | 3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-[2-(methylamino)-2-oxoethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide |
|---|---|
| PubChem CID | 70811535 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 3-[[(8R,9S,13S,14S,16R,17S)-17-hydroxy-13-methyl-3-[2-(methylamino)-2-oxoethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]methyl]benzamide |
| SMILES | CNC(=O)Cc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@@H](Cc3cccc(C(N)=O)c3)C[C@@H]12 |
| InChI | InChI=1S/C29H36N2O3/c1-29-11-10-23-22-8-6-18(15-26(32)31-2)12-19(22)7-9-24(23)25(29)16-21(27(29)33)14-17-4-3-5-20(13-17)28(30)34/h3-6,8,12-13,21,23-25,27,33H,7,9-11,14-16H2,1-2H3,(H2,30,34)(H,31,32)/t21-,23+,24+,25-,27-,29-/m0/s1 |
| InChIKey | PWCJKHUSUDJCHW-URIRLFJHSA-N |
| XLogP | 3.76 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |