About N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide
N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide (PubChem CID 70811745) has the molecular formula C14H28F3N3O2S
and a molecular weight of 359.46 g/mol. Its IUPAC name is N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide |
| PubChem CID | 70811745 |
| Molecular Formula | C14H28F3N3O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide |
| SMILES | CCC(C)N1CCN(CC(F)(F)F)CC1CN(CC)S(C)(=O)=O |
| InChI | InChI=1S/C14H28F3N3O2S/c1-5-12(3)20-8-7-18(11-14(15,16)17)9-13(20)10-19(6-2)23(4,21)22/h12-13H,5-11H2,1-4H3 |
| InChIKey | RHUQOYBPSMQAJE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide?
The IUPAC name of N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide (CID 70811745) is N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide.
What is the SMILES notation for N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide?
The canonical SMILES for N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide is CCC(C)N1CCN(CC(F)(F)F)CC1CN(CC)S(C)(=O)=O.
What is the InChIKey of N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide?
The InChIKey is RHUQOYBPSMQAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28F3N3O2S/c1-5-12(3)20-8-7-18(11-14(15,16)17)9-13(20)10-19(6-2)23(4,21)22/h12-13H,5-11H2,1-4H3.
What are the key properties of N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide?
N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide has a molecular weight of 359.46 g/mol, XLogP of 1.61, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-butan-2-yl-4-(2,2,2-trifluoroethyl)piperazin-2-yl]methyl]-N-ethylmethanesulfonamide is sourced from PubChem (CID 70811745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).