About 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile
2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile (PubChem CID 70812252) has the molecular formula C19H9F2N3
and a molecular weight of 317.30 g/mol. Its IUPAC name is 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile.
Molecular Properties
| Compound Name | 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile |
| PubChem CID | 70812252 |
| Molecular Formula | C19H9F2N3 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile |
| SMILES | N#Cc1c2[nH]c3ccc(F)cc3c2cc2c1[nH]c1ccc(F)cc12 |
| InChI | InChI=1S/C19H9F2N3/c20-9-1-3-16-11(5-9)13-7-14-12-6-10(21)2-4-17(12)24-19(14)15(8-22)18(13)23-16/h1-7,23-24H |
| InChIKey | YAKNRDMPSGROPY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile?
The IUPAC name of 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile (CID 70812252) is 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile.
What is the SMILES notation for 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile?
The canonical SMILES for 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile is N#Cc1c2[nH]c3ccc(F)cc3c2cc2c1[nH]c1ccc(F)cc12.
What is the InChIKey of 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile?
The InChIKey is YAKNRDMPSGROPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H9F2N3/c20-9-1-3-16-11(5-9)13-7-14-12-6-10(21)2-4-17(12)24-19(14)15(8-22)18(13)23-16/h1-7,23-24H.
What are the key properties of 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile?
2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile has a molecular weight of 317.30 g/mol, XLogP of 5.11, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazole-6-carbonitrile is sourced from PubChem (CID 70812252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).