C22H32N2O5 — CID 70812971
butyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]pyrrolidine-2-carboxylate (PubChem CID 70812971) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is butyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]pyrrolidine-2-carboxylate.
| Compound Name | butyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70812971 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | butyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O5/c1-5-6-15-28-20(26)17-13-10-14-24(17)19(25)18(16-11-8-7-9-12-16)23-21(27)29-22(2,3)4/h7-9,11-12,17-18H,5-6,10,13-15H2,1-4H3,(H,23,27)/t17-,18-/m0/s1 |
| InChIKey | ODKCWZACJDSECS-ROUUACIJSA-N |
| XLogP | 3.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|