C10H14O5 — CID 70813221
4,4,9-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 70813221) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4,4,9-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | 4,4,9-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 70813221 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4,4,9-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | CC1C(=O)OC2C3OC(C)(C)OC3OC12 |
| InChI | InChI=1S/C10H14O5/c1-4-5-6(12-8(4)11)7-9(13-5)15-10(2,3)14-7/h4-7,9H,1-3H3 |
| InChIKey | FNPBADGQNFZCFA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |