About (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid
(2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid (PubChem CID 70813489) has the molecular formula C9H10BrNO3S
and a molecular weight of 292.15 g/mol. Its IUPAC name is (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid.
Molecular Properties
| Compound Name | (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid |
| PubChem CID | 70813489 |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1OCCc2sc(Br)cc21 |
| InChI | InChI=1S/C9H10BrNO3S/c1-11(9(12)13)8-5-4-7(10)15-6(5)2-3-14-8/h4,8H,2-3H2,1H3,(H,12,13) |
| InChIKey | GAAJDASQDILENN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid?
The IUPAC name of (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid (CID 70813489) is (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid.
What is the SMILES notation for (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid?
The canonical SMILES for (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid is CN(C(=O)O)C1OCCc2sc(Br)cc21.
What is the InChIKey of (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid?
The InChIKey is GAAJDASQDILENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO3S/c1-11(9(12)13)8-5-4-7(10)15-6(5)2-3-14-8/h4,8H,2-3H2,1H3,(H,12,13).
What are the key properties of (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid?
(2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid has a molecular weight of 292.15 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-methylcarbamic acid is sourced from PubChem (CID 70813489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).