C26H25N5O3 — CID 70813517
3-[6-[[(2R)-5-phenylpentan-2-yl]carbamoylamino]pyrido[2,3-b]pyrazin-3-yl]benzoic acid (PubChem CID 70813517) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-[6-[[(2R)-5-phenylpentan-2-yl]carbamoylamino]pyrido[2,3-b]pyrazin-3-yl]benzoic acid.
| Compound Name | 3-[6-[[(2R)-5-phenylpentan-2-yl]carbamoylamino]pyrido[2,3-b]pyrazin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 70813517 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[6-[[(2R)-5-phenylpentan-2-yl]carbamoylamino]pyrido[2,3-b]pyrazin-3-yl]benzoic acid |
| SMILES | C[C@H](CCCc1ccccc1)NC(=O)Nc1ccc2ncc(-c3cccc(C(=O)O)c3)nc2n1 |
| InChI | InChI=1S/C26H25N5O3/c1-17(7-5-10-18-8-3-2-4-9-18)28-26(34)31-23-14-13-21-24(30-23)29-22(16-27-21)19-11-6-12-20(15-19)25(32)33/h2-4,6,8-9,11-17H,5,7,10H2,1H3,(H,32,33)(H2,28,29,30,31,34)/t17-/m1/s1 |
| InChIKey | AFDKXUCGBCYLCU-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |