C27H28N6O3 — CID 70813541
(2S)-2-amino-3-[4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl]propanoic acid (PubChem CID 70813541) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70813541 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (2S)-2-amino-3-[4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(-c2cnc3ccc(NC(=O)NCCCCc4ccccc4)nc3n2)cc1)C(=O)O |
| InChI | InChI=1S/C27H28N6O3/c28-21(26(34)35)16-19-9-11-20(12-10-19)23-17-30-22-13-14-24(32-25(22)31-23)33-27(36)29-15-5-4-8-18-6-2-1-3-7-18/h1-3,6-7,9-14,17,21H,4-5,8,15-16,28H2,(H,34,35)(H2,29,31,32,33,36)/t21-/m0/s1 |
| InChIKey | RRPSJYRYDSYTQG-NRFANRHFSA-N |
| XLogP | 3.79 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|