C13H7N3Se — CID 70813581
17-selena-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 70813581) has the molecular formula C13H7N3Se and a molecular weight of 284.18 g/mol. Its IUPAC name is 17-selena-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 17-selena-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 70813581 |
| Molecular Formula | C13H7N3Se |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 17-selena-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | c1ccc2nc3[se]c4cncnc4c3cc2c1 |
| InChI | InChI=1S/C13H7N3Se/c1-2-4-10-8(3-1)5-9-12-11(6-14-7-15-12)17-13(9)16-10/h1-7H |
| InChIKey | YRJQROPESMFJKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|