C26H25N5O4 — CID 70813608
2-methoxy-4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid (PubChem CID 70813608) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-methoxy-4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid.
| Compound Name | 2-methoxy-4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 70813608 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-methoxy-4-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid |
| SMILES | COc1cc(-c2cnc3ccc(NC(=O)NCCCCc4ccccc4)nc3n2)ccc1C(=O)O |
| InChI | InChI=1S/C26H25N5O4/c1-35-22-15-18(10-11-19(22)25(32)33)21-16-28-20-12-13-23(30-24(20)29-21)31-26(34)27-14-6-5-9-17-7-3-2-4-8-17/h2-4,7-8,10-13,15-16H,5-6,9,14H2,1H3,(H,32,33)(H2,27,29,30,31,34) |
| InChIKey | HCOWABUPDFCPCU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|