C25H23N5O3 — CID 70813667
3-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid (PubChem CID 70813667) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid.
| Compound Name | 3-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 70813667 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 3-[6-(4-phenylbutylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]benzoic acid |
| SMILES | O=C(NCCCCc1ccccc1)Nc1ccc2ncc(-c3cccc(C(=O)O)c3)nc2n1 |
| InChI | InChI=1S/C25H23N5O3/c31-24(32)19-11-6-10-18(15-19)21-16-27-20-12-13-22(29-23(20)28-21)30-25(33)26-14-5-4-9-17-7-2-1-3-8-17/h1-3,6-8,10-13,15-16H,4-5,9,14H2,(H,31,32)(H2,26,28,29,30,33) |
| InChIKey | VSIDPCHFTXOQLH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|