C21H19ClF4N4O3 — CID 70815703
1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-[3-fluoro-4-(2-hydroxyethoxymethyl)phenyl]urea (PubChem CID 70815703) has the molecular formula C21H19ClF4N4O3 and a molecular weight of 486.85 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-[3-fluoro-4-(2-hydroxyethoxymethyl)phenyl]urea.
| Compound Name | 1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-[3-fluoro-4-(2-hydroxyethoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 70815703 |
| Molecular Formula | C21H19ClF4N4O3 |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-[3-fluoro-4-(2-hydroxyethoxymethyl)phenyl]urea |
| SMILES | O=C(NCc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1)Nc1ccc(COCCO)c(F)c1 |
| InChI | InChI=1S/C21H19ClF4N4O3/c22-14-2-1-3-16(8-14)30-17(10-19(29-30)21(24,25)26)11-27-20(32)28-15-5-4-13(18(23)9-15)12-33-7-6-31/h1-5,8-10,31H,6-7,11-12H2,(H2,27,28,32) |
| InChIKey | ISPZBAAQBYGWSY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|