About 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline
2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline (PubChem CID 70815934) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline.
Molecular Properties
| Compound Name | 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline |
| PubChem CID | 70815934 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline |
| SMILES | CC1=CC=C(C2=CN=C3C=CC=CC3N2)CC1 |
| InChI | InChI=1S/C15H16N2/c1-11-6-8-12(9-7-11)15-10-16-13-4-2-3-5-14(13)17-15/h2-6,8,10,14,17H,7,9H2,1H3 |
| InChIKey | LPRLXRPDGHWSGL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline?
The IUPAC name of 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline (CID 70815934) is 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline.
What is the SMILES notation for 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline?
The canonical SMILES for 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline is CC1=CC=C(C2=CN=C3C=CC=CC3N2)CC1.
What is the InChIKey of 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline?
The InChIKey is LPRLXRPDGHWSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-11-6-8-12(9-7-11)15-10-16-13-4-2-3-5-14(13)17-15/h2-6,8,10,14,17H,7,9H2,1H3.
What are the key properties of 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline?
2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline has a molecular weight of 224.31 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylcyclohexa-1,3-dien-1-yl)-1,8a-dihydroquinoxaline is sourced from PubChem (CID 70815934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).