C22H20ClF4N5O2 — CID 70816127
1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)urea (PubChem CID 70816127) has the molecular formula C22H20ClF4N5O2 and a molecular weight of 497.88 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)urea.
| Compound Name | 1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 70816127 |
| Molecular Formula | C22H20ClF4N5O2 |
| Molecular Weight | 497.88 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)urea |
| SMILES | O=C(NCc1cc(C(F)(F)F)nn1-c1cccc(Cl)c1)Nc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C22H20ClF4N5O2/c23-14-2-1-3-16(10-14)32-17(12-20(30-32)22(25,26)27)13-28-21(33)29-15-4-5-19(18(24)11-15)31-6-8-34-9-7-31/h1-5,10-12H,6-9,13H2,(H2,28,29,33) |
| InChIKey | JFINRVZDLYVTBH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|