C28H31N5O4 — CID 70816615
1-[3-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea (PubChem CID 70816615) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-[3-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea.
| Compound Name | 1-[3-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 70816615 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-[3-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
| SMILES | O=C(NCCCCc1ccccc1)Nc1ccc2ncc(-c3ccc(OCCOCCO)cc3)nc2n1 |
| InChI | InChI=1S/C28H31N5O4/c34-16-17-36-18-19-37-23-11-9-22(10-12-23)25-20-30-24-13-14-26(32-27(24)31-25)33-28(35)29-15-5-4-8-21-6-2-1-3-7-21/h1-3,6-7,9-14,20,34H,4-5,8,15-19H2,(H2,29,31,32,33,35) |
| InChIKey | KXPAFONJDDXHFV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|