About pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate
pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate (PubChem CID 70818234) has the molecular formula C13H21N2O2+
and a molecular weight of 237.32 g/mol. Its IUPAC name is pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate |
| PubChem CID | 70818234 |
| Molecular Formula | C13H21N2O2+ |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OC[n+]1ccccc1)C(C)C |
| InChI | InChI=1S/C13H21N2O2/c1-11(2)15(12(3)4)13(16)17-10-14-8-6-5-7-9-14/h5-9,11-12H,10H2,1-4H3/q+1 |
| InChIKey | AKVWJYFCSGCMGC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate?
The IUPAC name of pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate (CID 70818234) is pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate?
The canonical SMILES for pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate is CC(C)N(C(=O)OC[n+]1ccccc1)C(C)C.
What is the InChIKey of pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate?
The InChIKey is AKVWJYFCSGCMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N2O2/c1-11(2)15(12(3)4)13(16)17-10-14-8-6-5-7-9-14/h5-9,11-12H,10H2,1-4H3/q+1.
What are the key properties of pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate?
pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate has a molecular weight of 237.32 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-ylmethyl N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 70818234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).