About (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid
(6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid (PubChem CID 70818261) has the molecular formula C11H12BrN3O3
and a molecular weight of 314.14 g/mol. Its IUPAC name is (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid.
Molecular Properties
| Compound Name | (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid |
| PubChem CID | 70818261 |
| Molecular Formula | C11H12BrN3O3 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid |
| SMILES | COCCN(C(=O)O)c1cc(Br)cn2ccnc12 |
| InChI | InChI=1S/C11H12BrN3O3/c1-18-5-4-15(11(16)17)9-6-8(12)7-14-3-2-13-10(9)14/h2-3,6-7H,4-5H2,1H3,(H,16,17) |
| InChIKey | QWXOQYJNTLUKAT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid?
The IUPAC name of (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid (CID 70818261) is (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid.
What is the SMILES notation for (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid?
The canonical SMILES for (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid is COCCN(C(=O)O)c1cc(Br)cn2ccnc12.
What is the InChIKey of (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid?
The InChIKey is QWXOQYJNTLUKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrN3O3/c1-18-5-4-15(11(16)17)9-6-8(12)7-14-3-2-13-10(9)14/h2-3,6-7H,4-5H2,1H3,(H,16,17).
What are the key properties of (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid?
(6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid has a molecular weight of 314.14 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromoimidazo[1,2-a]pyridin-8-yl)-(2-methoxyethyl)carbamic acid is sourced from PubChem (CID 70818261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).