About N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide
N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide (PubChem CID 70818604) has the molecular formula C18H22FN3O4S
and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide |
| PubChem CID | 70818604 |
| Molecular Formula | C18H22FN3O4S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@H]1CCOC[C@@H]1COc1ccc(-c2ncc(F)cn2)cc1 |
| InChI | InChI=1S/C18H22FN3O4S/c1-2-27(23,24)22-17-7-8-25-11-14(17)12-26-16-5-3-13(4-6-16)18-20-9-15(19)10-21-18/h3-6,9-10,14,17,22H,2,7-8,11-12H2,1H3/t14-,17+/m1/s1 |
| InChIKey | PCUUHSLRCXVOIG-PBHICJAKSA-N |
| XLogP | 2.01 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide?
The IUPAC name of N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide (CID 70818604) is N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide.
What is the SMILES notation for N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide?
The canonical SMILES for N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide is CCS(=O)(=O)N[C@H]1CCOC[C@@H]1COc1ccc(-c2ncc(F)cn2)cc1.
What is the InChIKey of N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide?
The InChIKey is PCUUHSLRCXVOIG-PBHICJAKSA-N. The full InChI is InChI=1S/C18H22FN3O4S/c1-2-27(23,24)22-17-7-8-25-11-14(17)12-26-16-5-3-13(4-6-16)18-20-9-15(19)10-21-18/h3-6,9-10,14,17,22H,2,7-8,11-12H2,1H3/t14-,17+/m1/s1.
What are the key properties of N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide?
N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide has a molecular weight of 395.46 g/mol, XLogP of 2.01, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-3-[[4-(5-fluoropyrimidin-2-yl)phenoxy]methyl]oxan-4-yl]ethanesulfonamide is sourced from PubChem (CID 70818604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).