About N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide
N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide (PubChem CID 70818837) has the molecular formula C19H24N2O5S
and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide |
| PubChem CID | 70818837 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide |
| SMILES | Cc1cc(-c2ccc(OCC3COCCC3NS(=O)(=O)C3CC3)cc2)no1 |
| InChI | InChI=1S/C19H24N2O5S/c1-13-10-19(20-26-13)14-2-4-16(5-3-14)25-12-15-11-24-9-8-18(15)21-27(22,23)17-6-7-17/h2-5,10,15,17-18,21H,6-9,11-12H2,1H3 |
| InChIKey | PYBWEEUEUAAXAQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide?
The IUPAC name of N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide (CID 70818837) is N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide.
What is the SMILES notation for N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide?
The canonical SMILES for N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide is Cc1cc(-c2ccc(OCC3COCCC3NS(=O)(=O)C3CC3)cc2)no1.
What is the InChIKey of N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide?
The InChIKey is PYBWEEUEUAAXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O5S/c1-13-10-19(20-26-13)14-2-4-16(5-3-14)25-12-15-11-24-9-8-18(15)21-27(22,23)17-6-7-17/h2-5,10,15,17-18,21H,6-9,11-12H2,1H3.
What are the key properties of N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide?
N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide has a molecular weight of 392.48 g/mol, XLogP of 2.52, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[4-(5-methyl-1,2-oxazol-3-yl)phenoxy]methyl]oxan-4-yl]cyclopropanesulfonamide is sourced from PubChem (CID 70818837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).