About 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol
2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 70819138) has the molecular formula C16H12F3NOS
and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 70819138 |
| Molecular Formula | C16H12F3NOS |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccnc(-c2cccc3ccsc23)c1)C(F)(F)F |
| InChI | InChI=1S/C16H12F3NOS/c1-15(21,16(17,18)19)11-5-7-20-13(9-11)12-4-2-3-10-6-8-22-14(10)12/h2-9,21H,1H3 |
| InChIKey | OTNFQASUEIKHDF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol (CID 70819138) is 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol is CC(O)(c1ccnc(-c2cccc3ccsc23)c1)C(F)(F)F.
What is the InChIKey of 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol?
The InChIKey is OTNFQASUEIKHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F3NOS/c1-15(21,16(17,18)19)11-5-7-20-13(9-11)12-4-2-3-10-6-8-22-14(10)12/h2-9,21H,1H3.
What are the key properties of 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol?
2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol has a molecular weight of 323.34 g/mol, XLogP of 4.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-benzothiophen-7-yl)-4-pyridinyl]-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 70819138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).