About 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone
2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone (PubChem CID 708193) has the molecular formula C16H15NO2S3
and a molecular weight of 349.50 g/mol. Its IUPAC name is 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone |
| PubChem CID | 708193 |
| Molecular Formula | C16H15NO2S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone |
| SMILES | CCOc1ccc2nc(SCC(=O)c3ccc(C)s3)sc2c1 |
| InChI | InChI=1S/C16H15NO2S3/c1-3-19-11-5-6-12-15(8-11)22-16(17-12)20-9-13(18)14-7-4-10(2)21-14/h4-8H,3,9H2,1-2H3 |
| InChIKey | WKLURSPBAHDADP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone?
The IUPAC name of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone (CID 708193) is 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone.
What is the SMILES notation for 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone?
The canonical SMILES for 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone is CCOc1ccc2nc(SCC(=O)c3ccc(C)s3)sc2c1.
What is the InChIKey of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone?
The InChIKey is WKLURSPBAHDADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2S3/c1-3-19-11-5-6-12-15(8-11)22-16(17-12)20-9-13(18)14-7-4-10(2)21-14/h4-8H,3,9H2,1-2H3.
What are the key properties of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone?
2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone has a molecular weight of 349.50 g/mol, XLogP of 5.04, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-1-(5-methylthiophen-2-yl)ethanone is sourced from PubChem (CID 708193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).