About 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate
1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate (PubChem CID 70819486) has the molecular formula C19H18ClN3O2
and a molecular weight of 355.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate |
| PubChem CID | 70819486 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate |
| SMILES | CC(OC(=O)Nc1c(-c2ccccc2)cnn1C)c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN3O2/c1-13(15-10-6-7-11-17(15)20)25-19(24)22-18-16(12-21-23(18)2)14-8-4-3-5-9-14/h3-13H,1-2H3,(H,22,24) |
| InChIKey | SVHXRVCXCDHNAL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate?
The IUPAC name of 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate (CID 70819486) is 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate.
What is the SMILES notation for 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate?
The canonical SMILES for 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate is CC(OC(=O)Nc1c(-c2ccccc2)cnn1C)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate?
The InChIKey is SVHXRVCXCDHNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3O2/c1-13(15-10-6-7-11-17(15)20)25-19(24)22-18-16(12-21-23(18)2)14-8-4-3-5-9-14/h3-13H,1-2H3,(H,22,24).
What are the key properties of 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate?
1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate has a molecular weight of 355.83 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)ethyl N-(1-methyl-4-phenylpyrazol-5-yl)carbamate is sourced from PubChem (CID 70819486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).