C64H48N4 — CID 70819630
2-(7,7-dimethyl-5-phenyl-2,3-dihydroindeno[2,1-b]carbazol-2-yl)-5-(4,6-diphenylpyrimidin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 70819630) has the molecular formula C64H48N4 and a molecular weight of 873.12 g/mol. Its IUPAC name is 2-(7,7-dimethyl-5-phenyl-2,3-dihydroindeno[2,1-b]carbazol-2-yl)-5-(4,6-diphenylpyrimidin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 2-(7,7-dimethyl-5-phenyl-2,3-dihydroindeno[2,1-b]carbazol-2-yl)-5-(4,6-diphenylpyrimidin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 70819630 |
| Molecular Formula | C64H48N4 |
| Molecular Weight | 873.12 g/mol |
| Exact Mass | 872.39 |
| IUPAC Name | 2-(7,7-dimethyl-5-phenyl-2,3-dihydroindeno[2,1-b]carbazol-2-yl)-5-(4,6-diphenylpyrimidin-2-yl)-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4c(n(-c5ccccc5)c3cc21)=CCC(c1ccc2c(c1)c1cc3c(cc1n2-c1nc(-c2ccccc2)cc(-c2ccccc2)n1)C(C)(C)c1ccccc1-3)C=4 |
| InChI | InChI=1S/C64H48N4/c1-63(2)52-26-16-14-24-44(52)46-34-50-48-32-41(28-30-58(48)67(60(50)36-54(46)63)43-22-12-7-13-23-43)42-29-31-59-49(33-42)51-35-47-45-25-15-17-27-53(45)64(3,4)55(47)37-61(51)68(59)62-65-56(39-18-8-5-9-19-39)38-57(66-62)40-20-10-6-11-21-40/h5-27,29-38,41H,28H2,1-4H3 |
| InChIKey | VLKIPUZKCANVSD-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.12 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |